C14H23N3O4 — CID 61442853
1-[4-(cyclopropylmethyl)piperazine-1-carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 61442853) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethyl)piperazine-1-carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-(cyclopropylmethyl)piperazine-1-carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61442853 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[4-(cyclopropylmethyl)piperazine-1-carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C14H23N3O4/c18-11-7-12(13(19)20)17(9-11)14(21)16-5-3-15(4-6-16)8-10-1-2-10/h10-12,18H,1-9H2,(H,19,20) |
| InChIKey | DUXWYNCABPVQSU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |