About 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine
4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine (PubChem CID 61443626) has the molecular formula C10H16ClN3S
and a molecular weight of 245.78 g/mol. Its IUPAC name is 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine |
| PubChem CID | 61443626 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine |
| SMILES | CN(CC1CCCCC1)c1nsnc1Cl |
| InChI | InChI=1S/C10H16ClN3S/c1-14(10-9(11)12-15-13-10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3 |
| InChIKey | PPYKFUBPDSGLDA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine?
The IUPAC name of 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine (CID 61443626) is 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine.
What is the SMILES notation for 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine?
The canonical SMILES for 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine is CN(CC1CCCCC1)c1nsnc1Cl.
What is the InChIKey of 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine?
The InChIKey is PPYKFUBPDSGLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3S/c1-14(10-9(11)12-15-13-10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3.
What are the key properties of 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine?
4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine has a molecular weight of 245.78 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(cyclohexylmethyl)-N-methyl-1,2,5-thiadiazol-3-amine is sourced from PubChem (CID 61443626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).