About N-benzhydrylacetamide
N-benzhydrylacetamide (PubChem CID 614461) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is N-benzhydrylacetamide.
Molecular Properties
| Compound Name | N-benzhydrylacetamide |
| PubChem CID | 614461 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-benzhydrylacetamide |
| SMILES | CC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO/c1-12(17)16-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3,(H,16,17) |
| InChIKey | WEASGADRJWKQRE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzhydrylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydrylacetamide?
The IUPAC name of N-benzhydrylacetamide (CID 614461) is N-benzhydrylacetamide.
What is the SMILES notation for N-benzhydrylacetamide?
The canonical SMILES for N-benzhydrylacetamide is CC(=O)NC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-benzhydrylacetamide?
The InChIKey is WEASGADRJWKQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-12(17)16-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3,(H,16,17).
What are the key properties of N-benzhydrylacetamide?
N-benzhydrylacetamide has a molecular weight of 225.29 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydrylacetamide is sourced from PubChem (CID 614461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).