C11H19N5O3S2 — CID 61447495
N-butyl-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 61447495) has the molecular formula C11H19N5O3S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-butyl-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | N-butyl-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61447495 |
| Molecular Formula | C11H19N5O3S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-butyl-6-hydrazinyl-N-(2-hydroxyethyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CCCCN(CCO)S(=O)(=O)c1c(NN)nc2sccn12 |
| InChI | InChI=1S/C11H19N5O3S2/c1-2-3-4-15(5-7-17)21(18,19)10-9(14-12)13-11-16(10)6-8-20-11/h6,8,14,17H,2-5,7,12H2,1H3 |
| InChIKey | FBWOIDFYFRRUGP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|