C13H17ClN2O4 — CID 61447781
4-chloro-2-[[ethyl(2-methoxyethyl)carbamoyl]amino]benzoic acid (PubChem CID 61447781) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 4-chloro-2-[[ethyl(2-methoxyethyl)carbamoyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[ethyl(2-methoxyethyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61447781 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-chloro-2-[[ethyl(2-methoxyethyl)carbamoyl]amino]benzoic acid |
| SMILES | CCN(CCOC)C(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C13H17ClN2O4/c1-3-16(6-7-20-2)13(19)15-11-8-9(14)4-5-10(11)12(17)18/h4-5,8H,3,6-7H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | RLUWWGLZZDBXHA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |