C9H22N2O — CID 61448111
3-N-ethyl-3-N-(2-methoxyethyl)butane-2,3-diamine (PubChem CID 61448111) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-N-ethyl-3-N-(2-methoxyethyl)butane-2,3-diamine.
| Compound Name | 3-N-ethyl-3-N-(2-methoxyethyl)butane-2,3-diamine |
|---|---|
| PubChem CID | 61448111 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 3-N-ethyl-3-N-(2-methoxyethyl)butane-2,3-diamine |
| SMILES | CCN(CCOC)C(C)C(C)N |
| InChI | InChI=1S/C9H22N2O/c1-5-11(6-7-12-4)9(3)8(2)10/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | CWXVWLKOQOHZKL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |