C15H25ClN2S — CID 61449114
N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-4-ethyl-N-methylcyclohexan-1-amine (PubChem CID 61449114) has the molecular formula C15H25ClN2S and a molecular weight of 300.90 g/mol. Its IUPAC name is N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-4-ethyl-N-methylcyclohexan-1-amine.
| Compound Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-4-ethyl-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 61449114 |
| Molecular Formula | C15H25ClN2S |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl]-4-ethyl-N-methylcyclohexan-1-amine |
| SMILES | CCC1CCC(N(C)CCc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C15H25ClN2S/c1-3-12-4-6-14(7-5-12)18(2)9-8-15-17-13(10-16)11-19-15/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | XRIBEPBKHAJFFW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|