C11H18N2O — CID 61449915
2-N-(1-methoxypropan-2-yl)-2-N-methylbenzene-1,2-diamine (PubChem CID 61449915) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-N-(1-methoxypropan-2-yl)-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(1-methoxypropan-2-yl)-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 61449915 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-N-(1-methoxypropan-2-yl)-2-N-methylbenzene-1,2-diamine |
| SMILES | COCC(C)N(C)c1ccccc1N |
| InChI | InChI=1S/C11H18N2O/c1-9(8-14-3)13(2)11-7-5-4-6-10(11)12/h4-7,9H,8,12H2,1-3H3 |
| InChIKey | MOWAPPKKXOYANK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|