C13H11N3O — CID 614507
1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,11(15)-pentaen-16-one (PubChem CID 614507) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,11(15)-pentaen-16-one.
| Compound Name | 1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,11(15)-pentaen-16-one |
|---|---|
| PubChem CID | 614507 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,11(15)-pentaen-16-one |
| SMILES | O=c1c2c([nH]c3nc4ccccc4n13)CCC2 |
| InChI | InChI=1S/C13H11N3O/c17-12-8-4-3-6-9(8)14-13-15-10-5-1-2-7-11(10)16(12)13/h1-2,5,7H,3-4,6H2,(H,14,15) |
| InChIKey | GYNDUJWZFAJEDI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |