C12H24N2S — CID 61450716
3-[(4-ethylcyclohexyl)-methylamino]propanethioamide (PubChem CID 61450716) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 3-[(4-ethylcyclohexyl)-methylamino]propanethioamide.
| Compound Name | 3-[(4-ethylcyclohexyl)-methylamino]propanethioamide |
|---|---|
| PubChem CID | 61450716 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-[(4-ethylcyclohexyl)-methylamino]propanethioamide |
| SMILES | CCC1CCC(N(C)CCC(N)=S)CC1 |
| InChI | InChI=1S/C12H24N2S/c1-3-10-4-6-11(7-5-10)14(2)9-8-12(13)15/h10-11H,3-9H2,1-2H3,(H2,13,15) |
| InChIKey | VOXTWSIGDMAHNW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|