About N-(3,4-dimethylphenyl)-3,4-dimethylaniline
N-(3,4-dimethylphenyl)-3,4-dimethylaniline (PubChem CID 614511) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3,4-dimethylaniline.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-3,4-dimethylaniline |
| PubChem CID | 614511 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3,4-dimethylaniline |
| SMILES | Cc1ccc(Nc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C16H19N/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16/h5-10,17H,1-4H3 |
| InChIKey | IMQQPEKHINRTCE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,4-dimethylphenyl)-3,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-3,4-dimethylaniline?
The IUPAC name of N-(3,4-dimethylphenyl)-3,4-dimethylaniline (CID 614511) is N-(3,4-dimethylphenyl)-3,4-dimethylaniline.
What is the SMILES notation for N-(3,4-dimethylphenyl)-3,4-dimethylaniline?
The canonical SMILES for N-(3,4-dimethylphenyl)-3,4-dimethylaniline is Cc1ccc(Nc2ccc(C)c(C)c2)cc1C.
What is the InChIKey of N-(3,4-dimethylphenyl)-3,4-dimethylaniline?
The InChIKey is IMQQPEKHINRTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16/h5-10,17H,1-4H3.
What are the key properties of N-(3,4-dimethylphenyl)-3,4-dimethylaniline?
N-(3,4-dimethylphenyl)-3,4-dimethylaniline has a molecular weight of 225.33 g/mol, XLogP of 4.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-3,4-dimethylaniline is sourced from PubChem (CID 614511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).