C14H17N3S2 — CID 61452711
2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyridine-3-carbothioamide (PubChem CID 61452711) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyridine-3-carbothioamide.
| Compound Name | 2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61452711 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[propan-2-yl(thiophen-2-ylmethyl)amino]pyridine-3-carbothioamide |
| SMILES | CC(C)N(Cc1cccs1)c1ncccc1C(N)=S |
| InChI | InChI=1S/C14H17N3S2/c1-10(2)17(9-11-5-4-8-19-11)14-12(13(15)18)6-3-7-16-14/h3-8,10H,9H2,1-2H3,(H2,15,18) |
| InChIKey | DAMGCEXNJOFBAY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|