C12H18N2O — CID 61453395
2-N-cyclopropyl-2-N-(2-methoxyethyl)benzene-1,2-diamine (PubChem CID 61453395) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-N-cyclopropyl-2-N-(2-methoxyethyl)benzene-1,2-diamine.
| Compound Name | 2-N-cyclopropyl-2-N-(2-methoxyethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 61453395 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-N-cyclopropyl-2-N-(2-methoxyethyl)benzene-1,2-diamine |
| SMILES | COCCN(c1ccccc1N)C1CC1 |
| InChI | InChI=1S/C12H18N2O/c1-15-9-8-14(10-6-7-10)12-5-3-2-4-11(12)13/h2-5,10H,6-9,13H2,1H3 |
| InChIKey | HVDVKPRVTQQJQY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|