About N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine
N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 61453398) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine.
Analyze N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine (CID 61453398) is N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine is COCC(C)N(C)CCN.
What is the InChIKey of N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is MZNQIOWYTZNNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O/c1-7(6-10-3)9(2)5-4-8/h7H,4-6,8H2,1-3H3.
What are the key properties of N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine?
N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 146.23 g/mol, XLogP of -0.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-methoxypropan-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 61453398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).