C14H18FNO4S — CID 61453916
2-(cyclohexylmethylsulfonylamino)-4-fluorobenzoic acid (PubChem CID 61453916) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(cyclohexylmethylsulfonylamino)-4-fluorobenzoic acid.
| Compound Name | 2-(cyclohexylmethylsulfonylamino)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 61453916 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(cyclohexylmethylsulfonylamino)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1NS(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C14H18FNO4S/c15-11-6-7-12(14(17)18)13(8-11)16-21(19,20)9-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9H2,(H,17,18) |
| InChIKey | AOXHYSXEAKHLAO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |