C13H16N2O5S — CID 61455010
2-[[3-(3-cyanopropoxy)phenyl]sulfamoyl]propanoic acid (PubChem CID 61455010) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[[3-(3-cyanopropoxy)phenyl]sulfamoyl]propanoic acid.
| Compound Name | 2-[[3-(3-cyanopropoxy)phenyl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61455010 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[[3-(3-cyanopropoxy)phenyl]sulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Nc1cccc(OCCCC#N)c1 |
| InChI | InChI=1S/C13H16N2O5S/c1-10(13(16)17)21(18,19)15-11-5-4-6-12(9-11)20-8-3-2-7-14/h4-6,9-10,15H,2-3,8H2,1H3,(H,16,17) |
| InChIKey | HFFRMCSFQLZMGZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|