C12H15F2NO5S — CID 61455167
2-[1-[2-(difluoromethoxy)phenyl]ethylsulfamoyl]propanoic acid (PubChem CID 61455167) has the molecular formula C12H15F2NO5S and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-[1-[2-(difluoromethoxy)phenyl]ethylsulfamoyl]propanoic acid.
| Compound Name | 2-[1-[2-(difluoromethoxy)phenyl]ethylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61455167 |
| Molecular Formula | C12H15F2NO5S |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[1-[2-(difluoromethoxy)phenyl]ethylsulfamoyl]propanoic acid |
| SMILES | CC(NS(=O)(=O)C(C)C(=O)O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C12H15F2NO5S/c1-7(15-21(18,19)8(2)11(16)17)9-5-3-4-6-10(9)20-12(13)14/h3-8,12,15H,1-2H3,(H,16,17) |
| InChIKey | ZGHHUEMVZRACIU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |