C16H20FNO3 — CID 61455637
4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1-methoxypropan-2-yl)-N-methylbenzamide (PubChem CID 61455637) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1-methoxypropan-2-yl)-N-methylbenzamide.
| Compound Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1-methoxypropan-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 61455637 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1-methoxypropan-2-yl)-N-methylbenzamide |
| SMILES | COCC(C)N(C)C(=O)c1ccc(F)cc1C#CCCO |
| InChI | InChI=1S/C16H20FNO3/c1-12(11-21-3)18(2)16(20)15-8-7-14(17)10-13(15)6-4-5-9-19/h7-8,10,12,19H,5,9,11H2,1-3H3 |
| InChIKey | IXSZSPLWJLYXND-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|