C14H27N3O4 — CID 61455997
3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]-propan-2-ylamino]propanoic acid (PubChem CID 61455997) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 61455997 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 3-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]-propan-2-ylamino]propanoic acid |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)N(CCC(=O)O)C(C)C |
| InChI | InChI=1S/C14H27N3O4/c1-6-16(7-2)12(18)10-15(5)14(21)17(11(3)4)9-8-13(19)20/h11H,6-10H2,1-5H3,(H,19,20) |
| InChIKey | PYAQWHDKGNICBU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |