About 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide
4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide (PubChem CID 61456164) has the molecular formula C13H17N3O4S
and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide |
| PubChem CID | 61456164 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide |
| SMILES | CN1C(=O)c2ccc(NS(=O)(=O)CCCCN)cc2C1=O |
| InChI | InChI=1S/C13H17N3O4S/c1-16-12(17)10-5-4-9(8-11(10)13(16)18)15-21(19,20)7-3-2-6-14/h4-5,8,15H,2-3,6-7,14H2,1H3 |
| InChIKey | OLGRCVXHAXOHGU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide?
The IUPAC name of 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide (CID 61456164) is 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide.
What is the SMILES notation for 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide?
The canonical SMILES for 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide is CN1C(=O)c2ccc(NS(=O)(=O)CCCCN)cc2C1=O.
What is the InChIKey of 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide?
The InChIKey is OLGRCVXHAXOHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4S/c1-16-12(17)10-5-4-9(8-11(10)13(16)18)15-21(19,20)7-3-2-6-14/h4-5,8,15H,2-3,6-7,14H2,1H3.
What are the key properties of 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide?
4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide has a molecular weight of 311.36 g/mol, XLogP of 0.39, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)butane-1-sulfonamide is sourced from PubChem (CID 61456164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).