C12H13BrN2O2S2 — CID 61456214
3-bromo-N-methyl-N-(2-pyridin-4-ylethyl)thiophene-2-sulfonamide (PubChem CID 61456214) has the molecular formula C12H13BrN2O2S2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-(2-pyridin-4-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-methyl-N-(2-pyridin-4-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61456214 |
| Molecular Formula | C12H13BrN2O2S2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 3-bromo-N-methyl-N-(2-pyridin-4-ylethyl)thiophene-2-sulfonamide |
| SMILES | CN(CCc1ccncc1)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C12H13BrN2O2S2/c1-15(8-4-10-2-6-14-7-3-10)19(16,17)12-11(13)5-9-18-12/h2-3,5-7,9H,4,8H2,1H3 |
| InChIKey | ZMODNJGPPREGDC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |