About 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane
1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane (PubChem CID 61456355) has the molecular formula C6H14F3N3O2S
and a molecular weight of 249.26 g/mol. Its IUPAC name is 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane.
Molecular Properties
| Compound Name | 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane |
| PubChem CID | 61456355 |
| Molecular Formula | C6H14F3N3O2S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane |
| SMILES | CN(CCCN)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H14F3N3O2S/c1-12(4-2-3-10)15(13,14)11-5-6(7,8)9/h11H,2-5,10H2,1H3 |
| InChIKey | UQSLNDWRSSMLTI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane?
The IUPAC name of 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane (CID 61456355) is 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane.
What is the SMILES notation for 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane?
The canonical SMILES for 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane is CN(CCCN)S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane?
The InChIKey is UQSLNDWRSSMLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14F3N3O2S/c1-12(4-2-3-10)15(13,14)11-5-6(7,8)9/h11H,2-5,10H2,1H3.
What are the key properties of 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane?
1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane has a molecular weight of 249.26 g/mol, XLogP of -0.34, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[methyl(2,2,2-trifluoroethylsulfamoyl)amino]propane is sourced from PubChem (CID 61456355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).