About 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide
3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide (PubChem CID 61456409) has the molecular formula C9H11BrF3NO2S2
and a molecular weight of 366.22 g/mol. Its IUPAC name is 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
| PubChem CID | 61456409 |
| Molecular Formula | C9H11BrF3NO2S2 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C9H11BrF3NO2S2/c1-2-4-14(6-9(11,12)13)18(15,16)8-7(10)3-5-17-8/h3,5H,2,4,6H2,1H3 |
| InChIKey | OAOUQAOHZIGZLT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide?
The IUPAC name of 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide (CID 61456409) is 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide.
What is the SMILES notation for 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide?
The canonical SMILES for 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide is CCCN(CC(F)(F)F)S(=O)(=O)c1sccc1Br.
What is the InChIKey of 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide?
The InChIKey is OAOUQAOHZIGZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrF3NO2S2/c1-2-4-14(6-9(11,12)13)18(15,16)8-7(10)3-5-17-8/h3,5H,2,4,6H2,1H3.
What are the key properties of 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide?
3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide has a molecular weight of 366.22 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-propyl-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide is sourced from PubChem (CID 61456409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).