C10H12F2N2O4S — CID 61456632
ethyl 2-[(5-amino-2,4-difluorophenyl)sulfamoyl]acetate (PubChem CID 61456632) has the molecular formula C10H12F2N2O4S and a molecular weight of 294.28 g/mol. Its IUPAC name is ethyl 2-[(5-amino-2,4-difluorophenyl)sulfamoyl]acetate.
| Compound Name | ethyl 2-[(5-amino-2,4-difluorophenyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 61456632 |
| Molecular Formula | C10H12F2N2O4S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | ethyl 2-[(5-amino-2,4-difluorophenyl)sulfamoyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H12F2N2O4S/c1-2-18-10(15)5-19(16,17)14-9-4-8(13)6(11)3-7(9)12/h3-4,14H,2,5,13H2,1H3 |
| InChIKey | VGHVIUNXPHMNFS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|