C9H19N3O6S2 — CID 61457490
methyl 4-(4-sulfamoylpiperazin-1-yl)sulfonylbutanoate (PubChem CID 61457490) has the molecular formula C9H19N3O6S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 4-(4-sulfamoylpiperazin-1-yl)sulfonylbutanoate.
| Compound Name | methyl 4-(4-sulfamoylpiperazin-1-yl)sulfonylbutanoate |
|---|---|
| PubChem CID | 61457490 |
| Molecular Formula | C9H19N3O6S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | methyl 4-(4-sulfamoylpiperazin-1-yl)sulfonylbutanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C9H19N3O6S2/c1-18-9(13)3-2-8-19(14,15)11-4-6-12(7-5-11)20(10,16)17/h2-8H2,1H3,(H2,10,16,17) |
| InChIKey | ATJSSWZEKLQZQI-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |