C13H20N2O4S — CID 61457700
methyl 4-[(3-aminophenyl)methyl-methylsulfamoyl]butanoate (PubChem CID 61457700) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is methyl 4-[(3-aminophenyl)methyl-methylsulfamoyl]butanoate.
| Compound Name | methyl 4-[(3-aminophenyl)methyl-methylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 61457700 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methyl 4-[(3-aminophenyl)methyl-methylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N(C)Cc1cccc(N)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-15(10-11-5-3-6-12(14)9-11)20(17,18)8-4-7-13(16)19-2/h3,5-6,9H,4,7-8,10,14H2,1-2H3 |
| InChIKey | UCBCSQWXTKKISD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|