C14H17BrN2O2S2 — CID 61457749
N-[(3-aminophenyl)methyl]-3-bromo-N-propylthiophene-2-sulfonamide (PubChem CID 61457749) has the molecular formula C14H17BrN2O2S2 and a molecular weight of 389.34 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-3-bromo-N-propylthiophene-2-sulfonamide.
| Compound Name | N-[(3-aminophenyl)methyl]-3-bromo-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61457749 |
| Molecular Formula | C14H17BrN2O2S2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-3-bromo-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(Cc1cccc(N)c1)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C14H17BrN2O2S2/c1-2-7-17(10-11-4-3-5-12(16)9-11)21(18,19)14-13(15)6-8-20-14/h3-6,8-9H,2,7,10,16H2,1H3 |
| InChIKey | ZTGMTOSFTIFHPH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|