C6H4F7IO — CID 614586
4,4,5,5,6,6,6-heptafluoro-2-iodohex-2-en-1-ol (PubChem CID 614586) has the molecular formula C6H4F7IO and a molecular weight of 351.99 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-iodohex-2-en-1-ol.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-iodohex-2-en-1-ol |
|---|---|
| PubChem CID | 614586 |
| Molecular Formula | C6H4F7IO |
| Molecular Weight | 351.99 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-iodohex-2-en-1-ol |
| SMILES | OCC(I)=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F7IO/c7-4(8,1-3(14)2-15)5(9,10)6(11,12)13/h1,15H,2H2 |
| InChIKey | AAIXLNBYXIVUKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.99 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|