C14H14BrFN2O — CID 61458910
N-(4-bromo-2-fluorophenyl)-1-cyanocyclohexane-1-carboxamide (PubChem CID 61458910) has the molecular formula C14H14BrFN2O and a molecular weight of 325.18 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-1-cyanocyclohexane-1-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-1-cyanocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61458910 |
| Molecular Formula | C14H14BrFN2O |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-1-cyanocyclohexane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(Br)cc2F)CCCCC1 |
| InChI | InChI=1S/C14H14BrFN2O/c15-10-4-5-12(11(16)8-10)18-13(19)14(9-17)6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,18,19) |
| InChIKey | ZCLSDZLYYPZEPC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |