C13H20N2O4S — CID 61459319
ethyl 3-[(3-amino-2,6-dimethylphenyl)sulfamoyl]propanoate (PubChem CID 61459319) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl 3-[(3-amino-2,6-dimethylphenyl)sulfamoyl]propanoate.
| Compound Name | ethyl 3-[(3-amino-2,6-dimethylphenyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 61459319 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 3-[(3-amino-2,6-dimethylphenyl)sulfamoyl]propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)Nc1c(C)ccc(N)c1C |
| InChI | InChI=1S/C13H20N2O4S/c1-4-19-12(16)7-8-20(17,18)15-13-9(2)5-6-11(14)10(13)3/h5-6,15H,4,7-8,14H2,1-3H3 |
| InChIKey | OLCBVWJIVKCQCJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|