About methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate
methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate (PubChem CID 61460458) has the molecular formula C10H15N3O5S
and a molecular weight of 289.31 g/mol. Its IUPAC name is methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate.
Molecular Properties
| Compound Name | methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate |
| PubChem CID | 61460458 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1nnc(C2CC2)o1 |
| InChI | InChI=1S/C10H15N3O5S/c1-17-8(14)3-2-6-19(15,16)13-10-12-11-9(18-10)7-4-5-7/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | HCEHGDBQRJPRHC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate?
The IUPAC name of methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate (CID 61460458) is methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate.
What is the SMILES notation for methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate?
The canonical SMILES for methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate is COC(=O)CCCS(=O)(=O)Nc1nnc(C2CC2)o1.
What is the InChIKey of methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate?
The InChIKey is HCEHGDBQRJPRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O5S/c1-17-8(14)3-2-6-19(15,16)13-10-12-11-9(18-10)7-4-5-7/h7H,2-6H2,1H3,(H,12,13).
What are the key properties of methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate?
methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate has a molecular weight of 289.31 g/mol, XLogP of 0.64, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)sulfamoyl]butanoate is sourced from PubChem (CID 61460458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).