C15H25N5O — CID 61460772
1-piperidin-4-yl-N-(2-pyrazol-1-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 61460772) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-(2-pyrazol-1-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-(2-pyrazol-1-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61460772 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-piperidin-4-yl-N-(2-pyrazol-1-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCn1cccn1)C1CCCN1C1CCNCC1 |
| InChI | InChI=1S/C15H25N5O/c21-15(17-9-12-19-10-2-6-18-19)14-3-1-11-20(14)13-4-7-16-8-5-13/h2,6,10,13-14,16H,1,3-5,7-9,11-12H2,(H,17,21) |
| InChIKey | FQFBTRUPPYTBBZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |