About 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide
2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide (PubChem CID 6146088) has the molecular formula C23H30N2O4
and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide.
Molecular Properties
| Compound Name | 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide |
| PubChem CID | 6146088 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide |
| SMILES | CCCCC(O)(CCCC)C(=O)NN(C(=O)/C=C\c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4/c1-3-5-16-23(28,17-6-4-2)22(27)24-25(19-11-8-7-9-12-19)21(26)15-14-20-13-10-18-29-20/h7-15,18,28H,3-6,16-17H2,1-2H3,(H,24,27)/b15-14- |
| InChIKey | JAIXZWYRGPCDDX-PFONDFGASA-N |
| XLogP | 4.47 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide?
The IUPAC name of 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide (CID 6146088) is 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide.
What is the SMILES notation for 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide?
The canonical SMILES for 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide is CCCCC(O)(CCCC)C(=O)NN(C(=O)/C=C\c1ccco1)c1ccccc1.
What is the InChIKey of 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide?
The InChIKey is JAIXZWYRGPCDDX-PFONDFGASA-N. The full InChI is InChI=1S/C23H30N2O4/c1-3-5-16-23(28,17-6-4-2)22(27)24-25(19-11-8-7-9-12-19)21(26)15-14-20-13-10-18-29-20/h7-15,18,28H,3-6,16-17H2,1-2H3,(H,24,27)/b15-14-.
What are the key properties of 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide?
2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide has a molecular weight of 398.50 g/mol, XLogP of 4.47, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N'-[(Z)-3-(furan-2-yl)prop-2-enoyl]-2-hydroxy-N'-phenylhexanehydrazide is sourced from PubChem (CID 6146088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).