C8H12N4OS — CID 61460885
3-amino-N-(2-imidazol-1-ylethyl)-3-sulfanylidenepropanamide (PubChem CID 61460885) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-amino-N-(2-imidazol-1-ylethyl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2-imidazol-1-ylethyl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 61460885 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-amino-N-(2-imidazol-1-ylethyl)-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C8H12N4OS/c9-7(14)5-8(13)11-2-4-12-3-1-10-6-12/h1,3,6H,2,4-5H2,(H2,9,14)(H,11,13) |
| InChIKey | PIPSQNACHFKLRX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|