C8H10F7NO — CID 614617
N-butyl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 614617) has the molecular formula C8H10F7NO and a molecular weight of 269.16 g/mol. Its IUPAC name is N-butyl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-butyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 614617 |
| Molecular Formula | C8H10F7NO |
| Molecular Weight | 269.16 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-butyl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7NO/c1-2-3-4-16-5(17)6(9,10)7(11,12)8(13,14)15/h2-4H2,1H3,(H,16,17) |
| InChIKey | VVMBYVDOZXJXRJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|