C12H11F3N4O2 — CID 61463010
4-nitro-N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)aniline (PubChem CID 61463010) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-nitro-N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-nitro-N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 61463010 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-nitro-N-(2-pyrazol-1-ylethyl)-3-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCCn2cccn2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N4O2/c13-12(14,15)10-8-9(2-3-11(10)19(20)21)16-5-7-18-6-1-4-17-18/h1-4,6,8,16H,5,7H2 |
| InChIKey | YXLTYLNMHGWPSK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|