About 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid
5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 61464672) has the molecular formula C10H10N2O5S2
and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid |
| PubChem CID | 61464672 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(C(=O)O)o2)sc1C |
| InChI | InChI=1S/C10H10N2O5S2/c1-5-6(2)18-10(11-5)12-19(15,16)8-4-3-7(17-8)9(13)14/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | BJXNHRQBHJXUFO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid (CID 61464672) is 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid is Cc1nc(NS(=O)(=O)c2ccc(C(=O)O)o2)sc1C.
What is the InChIKey of 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid?
The InChIKey is BJXNHRQBHJXUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5S2/c1-5-6(2)18-10(11-5)12-19(15,16)8-4-3-7(17-8)9(13)14/h3-4H,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid?
5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid has a molecular weight of 302.33 g/mol, XLogP of 1.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfamoyl]furan-2-carboxylic acid is sourced from PubChem (CID 61464672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).