C15H21N3O2S — CID 61464907
1-cyclohexyl-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione (PubChem CID 61464907) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 1-cyclohexyl-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61464907 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-cyclohexyl-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(NC2CC(=O)N(C3CCCCC3)C2=O)sc1C |
| InChI | InChI=1S/C15H21N3O2S/c1-9-10(2)21-15(16-9)17-12-8-13(19)18(14(12)20)11-6-4-3-5-7-11/h11-12H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | XGPSBFAPLQMUSC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|