About 7-nitroindeno[1,2-b]pyridin-5-one
7-nitroindeno[1,2-b]pyridin-5-one (PubChem CID 614657) has the molecular formula C12H6N2O3
and a molecular weight of 226.19 g/mol. Its IUPAC name is 7-nitroindeno[1,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-nitroindeno[1,2-b]pyridin-5-one |
| PubChem CID | 614657 |
| Molecular Formula | C12H6N2O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 7-nitroindeno[1,2-b]pyridin-5-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2ncccc21 |
| InChI | InChI=1S/C12H6N2O3/c15-12-9-2-1-5-13-11(9)8-4-3-7(14(16)17)6-10(8)12/h1-6H |
| InChIKey | UHKGMCVBCVDFKM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitroindeno[1,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitroindeno[1,2-b]pyridin-5-one?
The IUPAC name of 7-nitroindeno[1,2-b]pyridin-5-one (CID 614657) is 7-nitroindeno[1,2-b]pyridin-5-one.
What is the SMILES notation for 7-nitroindeno[1,2-b]pyridin-5-one?
The canonical SMILES for 7-nitroindeno[1,2-b]pyridin-5-one is O=C1c2cc([N+](=O)[O-])ccc2-c2ncccc21.
What is the InChIKey of 7-nitroindeno[1,2-b]pyridin-5-one?
The InChIKey is UHKGMCVBCVDFKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2O3/c15-12-9-2-1-5-13-11(9)8-4-3-7(14(16)17)6-10(8)12/h1-6H.
What are the key properties of 7-nitroindeno[1,2-b]pyridin-5-one?
7-nitroindeno[1,2-b]pyridin-5-one has a molecular weight of 226.19 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitroindeno[1,2-b]pyridin-5-one is sourced from PubChem (CID 614657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).