C10H16N4OS — CID 61467826
2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-N,N-dimethylpropanamide (PubChem CID 61467826) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-N,N-dimethylpropanamide.
| Compound Name | 2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 61467826 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C10H16N4OS/c1-6(9(15)13(2)3)14-8(7-4-5-7)11-12-10(14)16/h6-7H,4-5H2,1-3H3,(H,12,16) |
| InChIKey | MVRWQKYPWRNULG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|