C27H17N5O — CID 6146862
(E)-2-(1H-benzimidazol-2-yl)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 6146862) has the molecular formula C27H17N5O and a molecular weight of 427.47 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6146862 |
| Molecular Formula | C27H17N5O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H17N5O/c28-16-19(27-29-22-11-5-6-12-23(22)30-27)14-20-17-32(21-9-2-1-3-10-21)31-26(20)25-15-18-8-4-7-13-24(18)33-25/h1-15,17H,(H,29,30)/b19-14+ |
| InChIKey | DTCXFVNEUDHVEB-XMHGGMMESA-N |
| XLogP | 6.23 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|