C13H19N5O2S — CID 61468894
3-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-cyclohexylpyrrolidine-2,5-dione (PubChem CID 61468894) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 3-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-cyclohexylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-cyclohexylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61468894 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1-cyclohexylpyrrolidine-2,5-dione |
| SMILES | Cn1c(N)nnc1SC1CC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C13H19N5O2S/c1-17-12(14)15-16-13(17)21-9-7-10(19)18(11(9)20)8-5-3-2-4-6-8/h8-9H,2-7H2,1H3,(H2,14,15) |
| InChIKey | NXJCAMDQTXQMAW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|