C11H12ClN3S — CID 61468979
5-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-2,5-diamine (PubChem CID 61468979) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is 5-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-2,5-diamine.
| Compound Name | 5-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 61468979 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-N-[1-(5-chlorothiophen-2-yl)ethyl]pyridine-2,5-diamine |
| SMILES | CC(Nc1ccc(N)nc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12ClN3S/c1-7(9-3-4-10(12)16-9)15-8-2-5-11(13)14-6-8/h2-7,15H,1H3,(H2,13,14) |
| InChIKey | KZQBWAMOUFMDDR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |