C12H19FN2 — CID 61469418
3-fluoro-1-N-(2-methylpentan-3-yl)benzene-1,2-diamine (PubChem CID 61469418) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-fluoro-1-N-(2-methylpentan-3-yl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-(2-methylpentan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 61469418 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-fluoro-1-N-(2-methylpentan-3-yl)benzene-1,2-diamine |
| SMILES | CCC(Nc1cccc(F)c1N)C(C)C |
| InChI | InChI=1S/C12H19FN2/c1-4-10(8(2)3)15-11-7-5-6-9(13)12(11)14/h5-8,10,15H,4,14H2,1-3H3 |
| InChIKey | FVGUBDUBRMRHQT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|