C15H22N6 — CID 61470238
5-[1-(2-ethylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 61470238) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[1-(2-ethylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine.
| Compound Name | 5-[1-(2-ethylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 61470238 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 5-[1-(2-ethylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | CCC1CCCCC1n1nnnc1-c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C15H22N6/c1-2-10-5-3-4-6-14(10)21-15(18-19-20-21)11-7-12(16)9-13(17)8-11/h7-10,14H,2-6,16-17H2,1H3 |
| InChIKey | YGFOKPUWBYWSOU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|