C12H15ClN2O4S — CID 61470725
(2S)-1-[1-(5-chlorothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 61470725) has the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. Its IUPAC name is (2S)-1-[1-(5-chlorothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[1-(5-chlorothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61470725 |
| Molecular Formula | C12H15ClN2O4S |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (2S)-1-[1-(5-chlorothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(=O)N1CC(O)C[C@H]1C(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H15ClN2O4S/c1-6(9-2-3-10(13)20-9)14-12(19)15-5-7(16)4-8(15)11(17)18/h2-3,6-8,16H,4-5H2,1H3,(H,14,19)(H,17,18)/t6?,7?,8-/m0/s1 |
| InChIKey | IONFEURFHZPMAN-RRQHEKLDSA-N |
| XLogP | 1.69 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |