C13H16N4OS — CID 61472147
2,4-diamino-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 61472147) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 2,4-diamino-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,4-diamino-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 61472147 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2,4-diamino-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCc1nc(NC(=O)c2ccc(N)cc2N)sc1C |
| InChI | InChI=1S/C13H16N4OS/c1-3-11-7(2)19-13(16-11)17-12(18)9-5-4-8(14)6-10(9)15/h4-6H,3,14-15H2,1-2H3,(H,16,17,18) |
| InChIKey | RKSZEJBMLMNYFU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|