C13H13Br2N3O2S — CID 61475283
3-amino-4-(2,4-dibromoanilino)-N-methylbenzenesulfonamide (PubChem CID 61475283) has the molecular formula C13H13Br2N3O2S and a molecular weight of 435.14 g/mol. Its IUPAC name is 3-amino-4-(2,4-dibromoanilino)-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-4-(2,4-dibromoanilino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61475283 |
| Molecular Formula | C13H13Br2N3O2S |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 3-amino-4-(2,4-dibromoanilino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Nc2ccc(Br)cc2Br)c(N)c1 |
| InChI | InChI=1S/C13H13Br2N3O2S/c1-17-21(19,20)9-3-5-13(11(16)7-9)18-12-4-2-8(14)6-10(12)15/h2-7,17-18H,16H2,1H3 |
| InChIKey | MLJKWMPBFHXDTG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|