C9H9N3O3S — CID 61477759
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)imidazolidine-2,4,5-trione (PubChem CID 61477759) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 61477759 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)imidazolidine-2,4,5-trione |
| SMILES | CCc1nc(N2C(=O)NC(=O)C2=O)sc1C |
| InChI | InChI=1S/C9H9N3O3S/c1-3-5-4(2)16-9(10-5)12-7(14)6(13)11-8(12)15/h3H2,1-2H3,(H,11,13,15) |
| InChIKey | FOIKNBXYLDXJKR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|