About N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine
N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine (PubChem CID 61481983) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine |
| PubChem CID | 61481983 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C13H22N2/c1-4-15(8-7-14)10-13-9-11(2)5-6-12(13)3/h5-6,9H,4,7-8,10,14H2,1-3H3 |
| InChIKey | NSHRZNFFFSZCLP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine?
The IUPAC name of N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine (CID 61481983) is N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine.
What is the SMILES notation for N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine?
The canonical SMILES for N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine is CCN(CCN)Cc1cc(C)ccc1C.
What is the InChIKey of N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine?
The InChIKey is NSHRZNFFFSZCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-4-15(8-7-14)10-13-9-11(2)5-6-12(13)3/h5-6,9H,4,7-8,10,14H2,1-3H3.
What are the key properties of N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine?
N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine has a molecular weight of 206.33 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2,5-dimethylphenyl)methyl]-N'-ethylethane-1,2-diamine is sourced from PubChem (CID 61481983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).